C39H56N+ — CID 123308472
6-tert-butyl-9,10-diethyl-9,10,17,20,20-pentamethyl-17-pentyl-11-azoniapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),2(11),3(8),4,6,12,14,16(21)-octaene (PubChem CID 123308472) has the molecular formula C39H56N+ and a molecular weight of 538.88 g/mol. Its IUPAC name is 6-tert-butyl-9,10-diethyl-9,10,17,20,20-pentamethyl-17-pentyl-11-azoniapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),2(11),3(8),4,6,12,14,16(21)-octaene.
| Compound Name | 6-tert-butyl-9,10-diethyl-9,10,17,20,20-pentamethyl-17-pentyl-11-azoniapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),2(11),3(8),4,6,12,14,16(21)-octaene |
|---|---|
| PubChem CID | 123308472 |
| Molecular Formula | C39H56N+ |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.44 |
| IUPAC Name | 6-tert-butyl-9,10-diethyl-9,10,17,20,20-pentamethyl-17-pentyl-11-azoniapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),2(11),3(8),4,6,12,14,16(21)-octaene |
| SMILES | CCCCCC1(C)CCC(C)(C)c2cc3c4[n+](ccc3cc21)C(C)(CC)C(C)(CC)c1cc(C(C)(C)C)ccc1-4 |
| InChI | InChI=1S/C39H56N/c1-12-15-16-20-37(9)22-21-36(7,8)32-26-30-27(24-33(32)37)19-23-40-34(30)29-18-17-28(35(4,5)6)25-31(29)38(10,13-2)39(40,11)14-3/h17-19,23-26H,12-16,20-22H2,1-11H3/q+1 |
| InChIKey | RBGYMGIISARSLO-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|