C23H36 — CID 142986955
1-ethyl-1,4,4,5,5,8,8-heptamethyl-2,3,6,7-tetrahydroanthracene (PubChem CID 142986955) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1-ethyl-1,4,4,5,5,8,8-heptamethyl-2,3,6,7-tetrahydroanthracene.
| Compound Name | 1-ethyl-1,4,4,5,5,8,8-heptamethyl-2,3,6,7-tetrahydroanthracene |
|---|---|
| PubChem CID | 142986955 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1-ethyl-1,4,4,5,5,8,8-heptamethyl-2,3,6,7-tetrahydroanthracene |
| SMILES | CCC1(C)CCC(C)(C)c2cc3c(cc21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C23H36/c1-9-23(8)13-12-22(6,7)18-14-16-17(15-19(18)23)21(4,5)11-10-20(16,2)3/h14-15H,9-13H2,1-8H3 |
| InChIKey | DJSFXPMDOZJFGY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |