C31H38N+ — CID 123420933
8-tert-butyl-2,5-dimethyl-16-(4-methylpentyl)-1-azoniapentacyclo[10.8.0.02,5.06,11.013,18]icosa-1(12),3,6(11),7,9,13(18),14,16,19-nonaene (PubChem CID 123420933) has the molecular formula C31H38N+ and a molecular weight of 424.65 g/mol. Its IUPAC name is 8-tert-butyl-2,5-dimethyl-16-(4-methylpentyl)-1-azoniapentacyclo[10.8.0.02,5.06,11.013,18]icosa-1(12),3,6(11),7,9,13(18),14,16,19-nonaene.
| Compound Name | 8-tert-butyl-2,5-dimethyl-16-(4-methylpentyl)-1-azoniapentacyclo[10.8.0.02,5.06,11.013,18]icosa-1(12),3,6(11),7,9,13(18),14,16,19-nonaene |
|---|---|
| PubChem CID | 123420933 |
| Molecular Formula | C31H38N+ |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 8-tert-butyl-2,5-dimethyl-16-(4-methylpentyl)-1-azoniapentacyclo[10.8.0.02,5.06,11.013,18]icosa-1(12),3,6(11),7,9,13(18),14,16,19-nonaene |
| SMILES | CC(C)CCCc1ccc2c3[n+](ccc2c1)C1(C)C=CC1(C)c1cc(C(C)(C)C)ccc1-3 |
| InChI | InChI=1S/C31H38N/c1-21(2)9-8-10-22-11-13-25-23(19-22)15-18-32-28(25)26-14-12-24(29(3,4)5)20-27(26)30(6)16-17-31(30,32)7/h11-21H,8-10H2,1-7H3/q+1 |
| InChIKey | HNUNNPURXTWLIK-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|