C28H35N — CID 123256289
3-(3-butyl-7,7-dimethylbenzo[g]fluoren-9-yl)pentan-3-amine (PubChem CID 123256289) has the molecular formula C28H35N and a molecular weight of 385.60 g/mol. Its IUPAC name is 3-(3-butyl-7,7-dimethylbenzo[g]fluoren-9-yl)pentan-3-amine.
| Compound Name | 3-(3-butyl-7,7-dimethylbenzo[g]fluoren-9-yl)pentan-3-amine |
|---|---|
| PubChem CID | 123256289 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 3-(3-butyl-7,7-dimethylbenzo[g]fluoren-9-yl)pentan-3-amine |
| SMILES | CCCCc1ccc2c3c(ccc2c1)C(C)(C)c1cc(C(N)(CC)CC)ccc1-3 |
| InChI | InChI=1S/C28H35N/c1-6-9-10-19-11-14-22-20(17-19)12-16-24-26(22)23-15-13-21(28(29,7-2)8-3)18-25(23)27(24,4)5/h11-18H,6-10,29H2,1-5H3 |
| InChIKey | KNOCXQCYMMXDRG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |