C35H36S — CID 134294416
3-butyl-7-(7-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzothiophene (PubChem CID 134294416) has the molecular formula C35H36S and a molecular weight of 488.74 g/mol. Its IUPAC name is 3-butyl-7-(7-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzothiophene.
| Compound Name | 3-butyl-7-(7-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzothiophene |
|---|---|
| PubChem CID | 134294416 |
| Molecular Formula | C35H36S |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 3-butyl-7-(7-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzothiophene |
| SMILES | CCCCc1ccc2c(c1)sc1cc(-c3ccc4c(c3)C(C)(C)c3cc(C(C)(C)C)ccc3-4)ccc12 |
| InChI | InChI=1S/C35H36S/c1-7-8-9-22-10-14-28-29-16-12-24(20-33(29)36-32(28)18-22)23-11-15-26-27-17-13-25(34(2,3)4)21-31(27)35(5,6)30(26)19-23/h10-21H,7-9H2,1-6H3 |
| InChIKey | IVLQBWXUPNWFJP-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |