C44H60S2 — CID 70911637
5-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-3-hexyl-2-[4-hexyl-5-(2-methylbutan-2-yl)thiophen-2-yl]thiophene (PubChem CID 70911637) has the molecular formula C44H60S2 and a molecular weight of 653.10 g/mol. Its IUPAC name is 5-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-3-hexyl-2-[4-hexyl-5-(2-methylbutan-2-yl)thiophen-2-yl]thiophene.
| Compound Name | 5-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-3-hexyl-2-[4-hexyl-5-(2-methylbutan-2-yl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 70911637 |
| Molecular Formula | C44H60S2 |
| Molecular Weight | 653.10 g/mol |
| Exact Mass | 652.41 |
| IUPAC Name | 5-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-3-hexyl-2-[4-hexyl-5-(2-methylbutan-2-yl)thiophen-2-yl]thiophene |
| SMILES | CCCCCCc1cc(-c2ccc3c(c2)C(C)(C)c2cc(C(C)(C)C)ccc2-3)sc1-c1cc(CCCCCC)c(C(C)(C)CC)s1 |
| InChI | InChI=1S/C44H60S2/c1-11-14-16-18-20-31-27-38(45-40(31)39-28-32(21-19-17-15-12-2)41(46-39)43(7,8)13-3)30-22-24-34-35-25-23-33(42(4,5)6)29-37(35)44(9,10)36(34)26-30/h22-29H,11-21H2,1-10H3 |
| InChIKey | YUPDVEJIERKYKR-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.10 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|