C46H44BrNS — CID 58232982
N-[4-(5-bromo-3-hexylthiophen-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine (PubChem CID 58232982) has the molecular formula C46H44BrNS and a molecular weight of 722.84 g/mol. Its IUPAC name is N-[4-(5-bromo-3-hexylthiophen-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-[4-(5-bromo-3-hexylthiophen-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 58232982 |
| Molecular Formula | C46H44BrNS |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | N-[4-(5-bromo-3-hexylthiophen-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
| SMILES | CCCCCCc1cc(Br)sc1-c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C46H44BrNS/c1-6-7-8-9-14-31-27-43(47)49-44(31)30-19-21-32(22-20-30)48(33-23-25-37-35-15-10-12-17-39(35)45(2,3)41(37)28-33)34-24-26-38-36-16-11-13-18-40(36)46(4,5)42(38)29-34/h10-13,15-29H,6-9,14H2,1-5H3 |
| InChIKey | DDVLWSFMHJOEOK-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|