C53H51NO3S2 — CID 87271681
5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexyl-2H-thiophene-5-carbaldehyde (PubChem CID 87271681) has the molecular formula C53H51NO3S2 and a molecular weight of 814.13 g/mol. Its IUPAC name is 5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexyl-2H-thiophene-5-carbaldehyde.
| Compound Name | 5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexyl-2H-thiophene-5-carbaldehyde |
|---|---|
| PubChem CID | 87271681 |
| Molecular Formula | C53H51NO3S2 |
| Molecular Weight | 814.13 g/mol |
| Exact Mass | 813.33 |
| IUPAC Name | 5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexyl-2H-thiophene-5-carbaldehyde |
| SMILES | CCCCCCC1=CCSC1(C=O)c1sc(-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c2c1OCCO2 |
| InChI | InChI=1S/C53H51NO3S2/c1-6-7-8-9-14-35-27-30-58-53(35,33-55)50-48-47(56-28-29-57-48)49(59-50)34-19-21-36(22-20-34)54(37-23-25-41-39-15-10-12-17-43(39)51(2,3)45(41)31-37)38-24-26-42-40-16-11-13-18-44(40)52(4,5)46(42)32-38/h10-13,15-27,31-33H,6-9,14,28-30H2,1-5H3 |
| InChIKey | RLHUKBHQYQEFIN-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.13 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|