C63H61N3OS3 — CID 141341869
5-[4-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-3-hexylthiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]-4-hexylthiophene-2-carbaldehyde (PubChem CID 141341869) has the molecular formula C63H61N3OS3 and a molecular weight of 972.40 g/mol. Its IUPAC name is 5-[4-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-3-hexylthiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]-4-hexylthiophene-2-carbaldehyde.
| Compound Name | 5-[4-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-3-hexylthiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]-4-hexylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 141341869 |
| Molecular Formula | C63H61N3OS3 |
| Molecular Weight | 972.40 g/mol |
| Exact Mass | 971.40 |
| IUPAC Name | 5-[4-[5-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-3-hexylthiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]-4-hexylthiophene-2-carbaldehyde |
| SMILES | CCCCCCc1cc(C=O)sc1-c1ccc(-c2sc(-c3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)cc2CCCCCC)c2nsnc12 |
| InChI | InChI=1S/C63H61N3OS3/c1-7-9-11-13-19-41-35-46(39-67)68-60(41)51-33-34-52(59-58(51)64-70-65-59)61-42(20-14-12-10-8-2)36-57(69-61)40-25-27-43(28-26-40)66(44-29-31-49-47-21-15-17-23-53(47)62(3,4)55(49)37-44)45-30-32-50-48-22-16-18-24-54(48)63(5,6)56(50)38-45/h15-18,21-39H,7-14,19-20H2,1-6H3 |
| InChIKey | UGVPMOVYCNPPCH-UHFFFAOYSA-N |
| XLogP | 18.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.40 |
| LogP ≤ 5 | 18.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|