C67H56N2O8S4 — CID 90057824
9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]fluorene-2,7-diamine (PubChem CID 90057824) has the molecular formula C67H56N2O8S4 and a molecular weight of 1145.46 g/mol. Its IUPAC name is 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]fluorene-2,7-diamine.
| Compound Name | 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]fluorene-2,7-diamine |
|---|---|
| PubChem CID | 90057824 |
| Molecular Formula | C67H56N2O8S4 |
| Molecular Weight | 1145.46 g/mol |
| Exact Mass | 1144.29 |
| IUPAC Name | 9,9-dimethyl-2-N,2-N,7-N,7-N-tetrakis[4-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)phenyl]fluorene-2,7-diamine |
| SMILES | Cc1sc(-c2ccc(N(c3ccc(-c4sc(C)c5c4OCCO5)cc3)c3ccc4c(c3)C(C)(C)c3cc(N(c5ccc(-c6sc(C)c7c6OCCO7)cc5)c5ccc(-c6sc(C)c7c6OCCO7)cc5)ccc3-4)cc2)c2c1OCCO2 |
| InChI | InChI=1S/C67H56N2O8S4/c1-37-55-59(74-31-27-70-55)63(78-37)41-7-15-45(16-8-41)68(46-17-9-42(10-18-46)64-60-56(38(2)79-64)71-28-32-75-60)49-23-25-51-52-26-24-50(36-54(52)67(5,6)53(51)35-49)69(47-19-11-43(12-20-47)65-61-57(39(3)80-65)72-29-33-76-61)48-21-13-44(14-22-48)66-62-58(40(4)81-66)73-30-34-77-62/h7-26,35-36H,27-34H2,1-6H3 |
| InChIKey | UKMVAZBSTLXUCF-UHFFFAOYSA-N |
| XLogP | 18.16 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.46 |
| LogP ≤ 5 | 18.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |