C75H80N2O8S4 — CID 90057816
2-N,2-N,7-N,7-N-tetrakis[4-(3,4-diethoxy-5-methylthiophen-2-yl)phenyl]-9,9-dimethylfluorene-2,7-diamine (PubChem CID 90057816) has the molecular formula C75H80N2O8S4 and a molecular weight of 1265.74 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-diethoxy-5-methylthiophen-2-yl)phenyl]-9,9-dimethylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-diethoxy-5-methylthiophen-2-yl)phenyl]-9,9-dimethylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 90057816 |
| Molecular Formula | C75H80N2O8S4 |
| Molecular Weight | 1265.74 g/mol |
| Exact Mass | 1264.48 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-diethoxy-5-methylthiophen-2-yl)phenyl]-9,9-dimethylfluorene-2,7-diamine |
| SMILES | CCOc1c(C)sc(-c2ccc(N(c3ccc(-c4sc(C)c(OCC)c4OCC)cc3)c3ccc4c(c3)C(C)(C)c3cc(N(c5ccc(-c6sc(C)c(OCC)c6OCC)cc5)c5ccc(-c6sc(C)c(OCC)c6OCC)cc5)ccc3-4)cc2)c1OCC |
| InChI | InChI=1S/C75H80N2O8S4/c1-15-78-63-45(9)86-71(67(63)82-19-5)49-23-31-53(32-24-49)76(54-33-25-50(26-34-54)72-68(83-20-6)64(79-16-2)46(10)87-72)57-39-41-59-60-42-40-58(44-62(60)75(13,14)61(59)43-57)77(55-35-27-51(28-36-55)73-69(84-21-7)65(80-17-3)47(11)88-73)56-37-29-52(30-38-56)74-70(85-22-8)66(81-18-4)48(12)89-74/h23-44H,15-22H2,1-14H3 |
| InChIKey | NQEIMRFYLXEAIP-UHFFFAOYSA-N |
| XLogP | 22.27 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.74 |
| LogP ≤ 5 | 22.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |