C59H78 — CID 123995996
2-tert-butyl-9-(3-hexyl-5-methylphenyl)-7-(2-methylbutan-2-yl)-9-[4-[4-(4-octylphenyl)phenyl]butyl]fluorene (PubChem CID 123995996) has the molecular formula C59H78 and a molecular weight of 787.27 g/mol. Its IUPAC name is 2-tert-butyl-9-(3-hexyl-5-methylphenyl)-7-(2-methylbutan-2-yl)-9-[4-[4-(4-octylphenyl)phenyl]butyl]fluorene.
| Compound Name | 2-tert-butyl-9-(3-hexyl-5-methylphenyl)-7-(2-methylbutan-2-yl)-9-[4-[4-(4-octylphenyl)phenyl]butyl]fluorene |
|---|---|
| PubChem CID | 123995996 |
| Molecular Formula | C59H78 |
| Molecular Weight | 787.27 g/mol |
| Exact Mass | 786.61 |
| IUPAC Name | 2-tert-butyl-9-(3-hexyl-5-methylphenyl)-7-(2-methylbutan-2-yl)-9-[4-[4-(4-octylphenyl)phenyl]butyl]fluorene |
| SMILES | CCCCCCCCc1ccc(-c2ccc(CCCCC3(c4cc(C)cc(CCCCCC)c4)c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)CC)cc43)cc2)cc1 |
| InChI | InChI=1S/C59H78/c1-10-13-15-17-18-20-23-45-26-30-48(31-27-45)49-32-28-46(29-33-49)24-21-22-38-59(52-40-44(4)39-47(41-52)25-19-16-14-11-2)55-42-50(57(5,6)7)34-36-53(55)54-37-35-51(43-56(54)59)58(8,9)12-3/h26-37,39-43H,10-25,38H2,1-9H3 |
| InChIKey | HXAFJXXYBJGHNB-UHFFFAOYSA-N |
| XLogP | 17.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.27 |
| LogP ≤ 5 | 17.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|