C84H91N3 — CID 88941299
2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[9-(4-hexylphenyl)-2,7-bis(3-methylpentan-3-yl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 88941299) has the molecular formula C84H91N3 and a molecular weight of 1142.67 g/mol. Its IUPAC name is 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[9-(4-hexylphenyl)-2,7-bis(3-methylpentan-3-yl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[9-(4-hexylphenyl)-2,7-bis(3-methylpentan-3-yl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 88941299 |
| Molecular Formula | C84H91N3 |
| Molecular Weight | 1142.67 g/mol |
| Exact Mass | 1141.72 |
| IUPAC Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[9-(4-hexylphenyl)-2,7-bis(3-methylpentan-3-yl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(C2(c3ccc(-c4ccc(-c5nc(-c6ccc(-c7ccc(C(C)(C)C)cc7)cc6)nc(-c6ccc(-c7ccc(C(C)(C)C)cc7)cc6)n5)cc4)cc3)c3cc(C(C)(CC)CC)ccc3-c3ccc(C(C)(CC)CC)cc32)cc1 |
| InChI | InChI=1S/C84H91N3/c1-14-19-20-21-22-57-23-43-69(44-24-57)84(75-55-71(82(12,15-2)16-3)51-53-73(75)74-54-52-72(56-76(74)84)83(13,17-4)18-5)70-49-41-63(42-50-70)60-29-35-66(36-30-60)79-86-77(64-31-25-58(26-32-64)61-37-45-67(46-38-61)80(6,7)8)85-78(87-79)65-33-27-59(28-34-65)62-39-47-68(48-40-62)81(9,10)11/h23-56H,14-22H2,1-13H3 |
| InChIKey | ARYMGYAFJRDECC-UHFFFAOYSA-N |
| XLogP | 23.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1142.67 |
| LogP ≤ 5 | 23.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|