C21H28S — CID 58202987
2,6-dibutyl-4,4-dimethylindeno[1,2-b]thiophene (PubChem CID 58202987) has the molecular formula C21H28S and a molecular weight of 312.52 g/mol. Its IUPAC name is 2,6-dibutyl-4,4-dimethylindeno[1,2-b]thiophene.
| Compound Name | 2,6-dibutyl-4,4-dimethylindeno[1,2-b]thiophene |
|---|---|
| PubChem CID | 58202987 |
| Molecular Formula | C21H28S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2,6-dibutyl-4,4-dimethylindeno[1,2-b]thiophene |
| SMILES | CCCCc1ccc2c(c1)C(C)(C)c1cc(CCCC)sc1-2 |
| InChI | InChI=1S/C21H28S/c1-5-7-9-15-11-12-17-18(13-15)21(3,4)19-14-16(10-8-6-2)22-20(17)19/h11-14H,5-10H2,1-4H3 |
| InChIKey | XOONGCRIINRWQY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |