C36H46O — CID 146439591
2-(2,6-dibutylanthracen-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 146439591) has the molecular formula C36H46O and a molecular weight of 494.76 g/mol. Its IUPAC name is 2-(2,6-dibutylanthracen-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(2,6-dibutylanthracen-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 146439591 |
| Molecular Formula | C36H46O |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 2-(2,6-dibutylanthracen-9-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CCCCc1ccc2c(-c3cc(C(C)(C)CC(C)(C)C)ccc3O)c3cc(CCCC)ccc3cc2c1 |
| InChI | InChI=1S/C36H46O/c1-8-10-12-25-15-18-30-28(20-25)22-27-16-14-26(13-11-9-2)21-31(27)34(30)32-23-29(17-19-33(32)37)36(6,7)24-35(3,4)5/h14-23,37H,8-13,24H2,1-7H3 |
| InChIKey | JOFMHTWTAXGLRH-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|