C35H46O2 — CID 151609819
[2-[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-4-octylphenyl]-phenylmethanone (PubChem CID 151609819) has the molecular formula C35H46O2 and a molecular weight of 498.75 g/mol. Its IUPAC name is [2-[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-4-octylphenyl]-phenylmethanone.
| Compound Name | [2-[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-4-octylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 151609819 |
| Molecular Formula | C35H46O2 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | [2-[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-4-octylphenyl]-phenylmethanone |
| SMILES | CCCCCCCCc1ccc(C(=O)c2ccccc2)c(-c2cc(C(C)(C)CC(C)(C)C)ccc2O)c1 |
| InChI | InChI=1S/C35H46O2/c1-7-8-9-10-11-13-16-26-19-21-29(33(37)27-17-14-12-15-18-27)30(23-26)31-24-28(20-22-32(31)36)35(5,6)25-34(2,3)4/h12,14-15,17-24,36H,7-11,13,16,25H2,1-6H3 |
| InChIKey | QMGHAJOJZONKHQ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|