C27H35NSi — CID 123395999
3-(3-butyl-7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)pentan-3-amine (PubChem CID 123395999) has the molecular formula C27H35NSi and a molecular weight of 401.67 g/mol. Its IUPAC name is 3-(3-butyl-7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)pentan-3-amine.
| Compound Name | 3-(3-butyl-7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)pentan-3-amine |
|---|---|
| PubChem CID | 123395999 |
| Molecular Formula | C27H35NSi |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 3-(3-butyl-7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)pentan-3-amine |
| SMILES | CCCCc1ccc2c3c(ccc2c1)[Si](C)(C)c1cc(C(N)(CC)CC)ccc1-3 |
| InChI | InChI=1S/C27H35NSi/c1-6-9-10-19-11-14-22-20(17-19)12-16-24-26(22)23-15-13-21(27(28,7-2)8-3)18-25(23)29(24,4)5/h11-18H,6-10,28H2,1-5H3 |
| InChIKey | SKNDAWJURIUYKT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|