About 4-butyl-2-(3,5-ditert-butylphenyl)phenol
4-butyl-2-(3,5-ditert-butylphenyl)phenol (PubChem CID 141194597) has the molecular formula C24H34O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-butyl-2-(3,5-ditert-butylphenyl)phenol.
Molecular Properties
| Compound Name | 4-butyl-2-(3,5-ditert-butylphenyl)phenol |
| PubChem CID | 141194597 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-butyl-2-(3,5-ditert-butylphenyl)phenol |
| SMILES | CCCCc1ccc(O)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H34O/c1-8-9-10-17-11-12-22(25)21(13-17)18-14-19(23(2,3)4)16-20(15-18)24(5,6)7/h11-16,25H,8-10H2,1-7H3 |
| InChIKey | OEDCWOBVOWRAND-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-2-(3,5-ditert-butylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-(3,5-ditert-butylphenyl)phenol?
The IUPAC name of 4-butyl-2-(3,5-ditert-butylphenyl)phenol (CID 141194597) is 4-butyl-2-(3,5-ditert-butylphenyl)phenol.
What is the SMILES notation for 4-butyl-2-(3,5-ditert-butylphenyl)phenol?
The canonical SMILES for 4-butyl-2-(3,5-ditert-butylphenyl)phenol is CCCCc1ccc(O)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1.
What is the InChIKey of 4-butyl-2-(3,5-ditert-butylphenyl)phenol?
The InChIKey is OEDCWOBVOWRAND-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O/c1-8-9-10-17-11-12-22(25)21(13-17)18-14-19(23(2,3)4)16-20(15-18)24(5,6)7/h11-16,25H,8-10H2,1-7H3.
What are the key properties of 4-butyl-2-(3,5-ditert-butylphenyl)phenol?
4-butyl-2-(3,5-ditert-butylphenyl)phenol has a molecular weight of 338.54 g/mol, XLogP of 7.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-(3,5-ditert-butylphenyl)phenol is sourced from PubChem (CID 141194597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).