C19H17N — CID 90277897
7,7-dimethylbenzo[g]fluoren-9-amine (PubChem CID 90277897) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 7,7-dimethylbenzo[g]fluoren-9-amine.
| Compound Name | 7,7-dimethylbenzo[g]fluoren-9-amine |
|---|---|
| PubChem CID | 90277897 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 7,7-dimethylbenzo[g]fluoren-9-amine |
| SMILES | CC1(C)c2cc(N)ccc2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C19H17N/c1-19(2)16-10-7-12-5-3-4-6-14(12)18(16)15-9-8-13(20)11-17(15)19/h3-11H,20H2,1-2H3 |
| InChIKey | SXJXNHZGGPVTOZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|