C23H28 — CID 90712910
7,7-dimethylbenzo[c]fluorene;ethane (PubChem CID 90712910) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 7,7-dimethylbenzo[c]fluorene;ethane.
| Compound Name | 7,7-dimethylbenzo[c]fluorene;ethane |
|---|---|
| PubChem CID | 90712910 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 7,7-dimethylbenzo[c]fluorene;ethane |
| SMILES | CC.CC.CC1(C)c2ccccc2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C19H16.2C2H6/c1-19(2)16-10-6-5-9-15(16)18-14-8-4-3-7-13(14)11-12-17(18)19;2*1-2/h3-12H,1-2H3;2*1-2H3 |
| InChIKey | JAMIAZUFDIVMAO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |