C62H52O — CID 122580507
3,4-dimethyl-2,5-bis(12,12,16,16-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17(22),18,20,23-undecaenyl)furan (PubChem CID 122580507) has the molecular formula C62H52O and a molecular weight of 813.10 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-bis(12,12,16,16-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17(22),18,20,23-undecaenyl)furan.
| Compound Name | 3,4-dimethyl-2,5-bis(12,12,16,16-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17(22),18,20,23-undecaenyl)furan |
|---|---|
| PubChem CID | 122580507 |
| Molecular Formula | C62H52O |
| Molecular Weight | 813.10 g/mol |
| Exact Mass | 812.40 |
| IUPAC Name | 3,4-dimethyl-2,5-bis(12,12,16,16-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17(22),18,20,23-undecaenyl)furan |
| SMILES | Cc1c(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)-c2c(ccc3ccccc23)C4(C)C)oc(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)-c2c(ccc3ccccc23)C4(C)C)c1C |
| InChI | InChI=1S/C62H52O/c1-33-34(2)58(38-20-24-42-44-30-46-54(32-52(44)62(9,10)50(42)28-38)60(5,6)48-26-22-36-16-12-14-18-40(36)56(46)48)63-57(33)37-19-23-41-43-29-45-53(31-51(43)61(7,8)49(41)27-37)59(3,4)47-25-21-35-15-11-13-17-39(35)55(45)47/h11-32H,1-10H3 |
| InChIKey | KCMCFENYDSMSAF-UHFFFAOYSA-N |
| XLogP | 16.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.10 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |