C49H54N2+2 — CID 123641816
8-butyl-1-[5-tert-butyl-2-[3-[2-(2-ethylphenyl)pyridin-1-ium-1-yl]butyl]phenyl]-2-methylnaphtho[2,1-f]isoquinolin-2-ium (PubChem CID 123641816) has the molecular formula C49H54N2+2 and a molecular weight of 670.98 g/mol. Its IUPAC name is 8-butyl-1-[5-tert-butyl-2-[3-[2-(2-ethylphenyl)pyridin-1-ium-1-yl]butyl]phenyl]-2-methylnaphtho[2,1-f]isoquinolin-2-ium.
| Compound Name | 8-butyl-1-[5-tert-butyl-2-[3-[2-(2-ethylphenyl)pyridin-1-ium-1-yl]butyl]phenyl]-2-methylnaphtho[2,1-f]isoquinolin-2-ium |
|---|---|
| PubChem CID | 123641816 |
| Molecular Formula | C49H54N2+2 |
| Molecular Weight | 670.98 g/mol |
| Exact Mass | 670.43 |
| IUPAC Name | 8-butyl-1-[5-tert-butyl-2-[3-[2-(2-ethylphenyl)pyridin-1-ium-1-yl]butyl]phenyl]-2-methylnaphtho[2,1-f]isoquinolin-2-ium |
| SMILES | CCCCc1ccc2c(ccc3c4cc[n+](C)c(-c5cc(C(C)(C)C)ccc5CCC(C)[n+]5ccccc5-c5ccccc5CC)c4ccc23)c1 |
| InChI | InChI=1S/C49H54N2/c1-8-10-15-35-20-25-40-38(32-35)23-26-43-42(40)27-28-45-44(43)29-31-50(7)48(45)46-33-39(49(4,5)6)24-22-37(46)21-19-34(3)51-30-14-13-18-47(51)41-17-12-11-16-36(41)9-2/h11-14,16-18,20,22-34H,8-10,15,19,21H2,1-7H3/q+2 |
| InChIKey | LQWKMWQUMGPUGU-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.98 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|