C31H39FN+ — CID 123856737
3-butyl-9,10-diethyl-14-fluoro-4,9,10,19,19-pentamethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene (PubChem CID 123856737) has the molecular formula C31H39FN+ and a molecular weight of 444.66 g/mol. Its IUPAC name is 3-butyl-9,10-diethyl-14-fluoro-4,9,10,19,19-pentamethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene.
| Compound Name | 3-butyl-9,10-diethyl-14-fluoro-4,9,10,19,19-pentamethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene |
|---|---|
| PubChem CID | 123856737 |
| Molecular Formula | C31H39FN+ |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 3-butyl-9,10-diethyl-14-fluoro-4,9,10,19,19-pentamethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1C)C(C)(CC)C(C)(CC)c1ccc(F)c(c1-4)C2(C)C |
| InChI | InChI=1S/C31H39FN/c1-9-12-13-20-18-23-25-21(19(20)4)16-17-33-28(25)26-22(30(7,10-2)31(33,8)11-3)14-15-24(32)27(26)29(23,5)6/h14-18H,9-13H2,1-8H3/q+1 |
| InChIKey | DMKYDTOJPQANFI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|