C27H27FN+ — CID 152793496
6,9-diethyl-2-fluoro-3,21,21-trimethyl-10-azoniahexacyclo[15.3.1.05,20.06,9.010,19.013,18]henicosa-1,3,5(20),7,10(19),11,13(18),14,16-nonaene (PubChem CID 152793496) has the molecular formula C27H27FN+ and a molecular weight of 384.52 g/mol. Its IUPAC name is 6,9-diethyl-2-fluoro-3,21,21-trimethyl-10-azoniahexacyclo[15.3.1.05,20.06,9.010,19.013,18]henicosa-1,3,5(20),7,10(19),11,13(18),14,16-nonaene.
| Compound Name | 6,9-diethyl-2-fluoro-3,21,21-trimethyl-10-azoniahexacyclo[15.3.1.05,20.06,9.010,19.013,18]henicosa-1,3,5(20),7,10(19),11,13(18),14,16-nonaene |
|---|---|
| PubChem CID | 152793496 |
| Molecular Formula | C27H27FN+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 6,9-diethyl-2-fluoro-3,21,21-trimethyl-10-azoniahexacyclo[15.3.1.05,20.06,9.010,19.013,18]henicosa-1,3,5(20),7,10(19),11,13(18),14,16-nonaene |
| SMILES | CCC12C=CC1(CC)[n+]1ccc3cccc4c3c1-c1c2cc(C)c(F)c1C4(C)C |
| InChI | InChI=1S/C27H27FN/c1-6-26-12-13-27(26,7-2)29-14-11-17-9-8-10-18-20(17)24(29)21-19(26)15-16(3)23(28)22(21)25(18,4)5/h8-15H,6-7H2,1-5H3/q+1 |
| InChIKey | BDLKPMFQAFQZQQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|