C18H20 — CID 173210949
1,1,2,3,4-pentamethylphenalene (PubChem CID 173210949) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,1,2,3,4-pentamethylphenalene.
| Compound Name | 1,1,2,3,4-pentamethylphenalene |
|---|---|
| PubChem CID | 173210949 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,1,2,3,4-pentamethylphenalene |
| SMILES | CC1=C(C)C(C)(C)c2cccc3ccc(C)c1c23 |
| InChI | InChI=1S/C18H20/c1-11-9-10-14-7-6-8-15-17(14)16(11)12(2)13(3)18(15,4)5/h6-10H,1-5H3 |
| InChIKey | ZDQLINAVNIGGIM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |