C18H23N — CID 177264720
1,1,2,3,3,4-hexamethylbenzo[de]isoquinoline (PubChem CID 177264720) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 1,1,2,3,3,4-hexamethylbenzo[de]isoquinoline.
| Compound Name | 1,1,2,3,3,4-hexamethylbenzo[de]isoquinoline |
|---|---|
| PubChem CID | 177264720 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1,1,2,3,3,4-hexamethylbenzo[de]isoquinoline |
| SMILES | Cc1ccc2cccc3c2c1C(C)(C)N(C)C3(C)C |
| InChI | InChI=1S/C18H23N/c1-12-10-11-13-8-7-9-14-15(13)16(12)18(4,5)19(6)17(14,2)3/h7-11H,1-6H3 |
| InChIKey | IJFWEPUHSXYIEK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |