C19H16FN — CID 134201762
6-fluoro-4,8,8-trimethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 134201762) has the molecular formula C19H16FN and a molecular weight of 277.34 g/mol. Its IUPAC name is 6-fluoro-4,8,8-trimethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 6-fluoro-4,8,8-trimethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 134201762 |
| Molecular Formula | C19H16FN |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-fluoro-4,8,8-trimethyl-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | Cc1cc(F)c2c(c1)-c1nccc3cccc(c13)C2(C)C |
| InChI | InChI=1S/C19H16FN/c1-11-9-13-17(15(20)10-11)19(2,3)14-6-4-5-12-7-8-21-18(13)16(12)14/h4-10H,1-3H3 |
| InChIKey | JAXULCOCSDILDO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |