C24H24N2Si — CID 164748679
(12,12-dimethyl-9,20-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5(10),6,8,13(21),14,16,18-decaen-15-yl)-trimethylsilane (PubChem CID 164748679) has the molecular formula C24H24N2Si and a molecular weight of 368.56 g/mol. Its IUPAC name is (12,12-dimethyl-9,20-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5(10),6,8,13(21),14,16,18-decaen-15-yl)-trimethylsilane.
| Compound Name | (12,12-dimethyl-9,20-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5(10),6,8,13(21),14,16,18-decaen-15-yl)-trimethylsilane |
|---|---|
| PubChem CID | 164748679 |
| Molecular Formula | C24H24N2Si |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (12,12-dimethyl-9,20-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2(11),3,5(10),6,8,13(21),14,16,18-decaen-15-yl)-trimethylsilane |
| SMILES | CC1(C)c2c(ccc3cccnc23)-c2nccc3cc([Si](C)(C)C)cc1c23 |
| InChI | InChI=1S/C24H24N2Si/c1-24(2)19-14-17(27(3,4)5)13-16-10-12-26-23(20(16)19)18-9-8-15-7-6-11-25-22(15)21(18)24/h6-14H,1-5H3 |
| InChIKey | GXFFRGXHYYOWIK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|