C41H45FN2O+2 — CID 123334442
4-butyl-9,9-diethyl-14-fluoro-10-[4-methoxy-2-(1-methylpyridin-1-ium-2-yl)phenyl]-19,19-dimethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene (PubChem CID 123334442) has the molecular formula C41H45FN2O+2 and a molecular weight of 600.82 g/mol. Its IUPAC name is 4-butyl-9,9-diethyl-14-fluoro-10-[4-methoxy-2-(1-methylpyridin-1-ium-2-yl)phenyl]-19,19-dimethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene.
| Compound Name | 4-butyl-9,9-diethyl-14-fluoro-10-[4-methoxy-2-(1-methylpyridin-1-ium-2-yl)phenyl]-19,19-dimethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene |
|---|---|
| PubChem CID | 123334442 |
| Molecular Formula | C41H45FN2O+2 |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 4-butyl-9,9-diethyl-14-fluoro-10-[4-methoxy-2-(1-methylpyridin-1-ium-2-yl)phenyl]-19,19-dimethyl-8-azoniapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),11(16),12,14-octaene |
| SMILES | CCCCc1ccc2c3c4[n+](ccc13)C(CC)(CC)C(c1ccc(OC)cc1-c1cccc[n+]1C)c1ccc(F)c(c1-4)C2(C)C |
| InChI | InChI=1S/C41H45FN2O/c1-8-11-14-26-16-20-32-35-28(26)22-24-44-39(35)36-30(19-21-33(42)38(36)40(32,4)5)37(41(44,9-2)10-3)29-18-17-27(45-7)25-31(29)34-15-12-13-23-43(34)6/h12-13,15-25,37H,8-11,14H2,1-7H3/q+2 |
| InChIKey | PDRFFGADWKTUFC-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|