C55H58N+ — CID 123136397
10-[3-[3-(3-butylphenyl)-5-(3-methylphenyl)phenyl]phenyl]-6-but-1-ynyl-6,7-diethyl-4,7-dimethyl-3-prop-1-enylbenzo[a]quinolizin-5-ium (PubChem CID 123136397) has the molecular formula C55H58N+ and a molecular weight of 733.08 g/mol. Its IUPAC name is 10-[3-[3-(3-butylphenyl)-5-(3-methylphenyl)phenyl]phenyl]-6-but-1-ynyl-6,7-diethyl-4,7-dimethyl-3-prop-1-enylbenzo[a]quinolizin-5-ium.
| Compound Name | 10-[3-[3-(3-butylphenyl)-5-(3-methylphenyl)phenyl]phenyl]-6-but-1-ynyl-6,7-diethyl-4,7-dimethyl-3-prop-1-enylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123136397 |
| Molecular Formula | C55H58N+ |
| Molecular Weight | 733.08 g/mol |
| Exact Mass | 732.46 |
| IUPAC Name | 10-[3-[3-(3-butylphenyl)-5-(3-methylphenyl)phenyl]phenyl]-6-but-1-ynyl-6,7-diethyl-4,7-dimethyl-3-prop-1-enylbenzo[a]quinolizin-5-ium |
| SMILES | CC=Cc1ccc2[n+](c1C)C(C#CCC)(CC)C(C)(CC)c1ccc(-c3cccc(-c4cc(-c5cccc(C)c5)cc(-c5cccc(CCCC)c5)c4)c3)cc1-2 |
| InChI | InChI=1S/C55H58N/c1-9-14-21-41-22-17-24-44(33-41)49-35-48(43-23-16-20-39(6)32-43)36-50(37-49)46-26-18-25-45(34-46)47-27-29-52-51(38-47)53-30-28-42(19-11-3)40(7)56(53)55(13-5,31-15-10-2)54(52,8)12-4/h11,16-20,22-30,32-38H,9-10,12-14,21H2,1-8H3/q+1 |
| InChIKey | JOCCOOZERNNBCW-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.08 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|