C43H50N2+2 — CID 123915715
3-butyl-11,11-diethyl-20,20-dimethyl-10-[[4-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]methyl]-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene (PubChem CID 123915715) has the molecular formula C43H50N2+2 and a molecular weight of 594.89 g/mol. Its IUPAC name is 3-butyl-11,11-diethyl-20,20-dimethyl-10-[[4-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]methyl]-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene.
| Compound Name | 3-butyl-11,11-diethyl-20,20-dimethyl-10-[[4-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]methyl]-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene |
|---|---|
| PubChem CID | 123915715 |
| Molecular Formula | C43H50N2+2 |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | 3-butyl-11,11-diethyl-20,20-dimethyl-10-[[4-methyl-2-(1-methylpyridin-1-ium-2-yl)phenyl]methyl]-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1)CC(Cc1ccc(C)cc1-c1cccc[n+]1C)C(CC)(CC)c1cccc(c1-4)C2(C)C |
| InChI | InChI=1S/C43H50N2/c1-8-11-15-30-25-32-21-23-45-28-33(27-31-20-19-29(4)24-34(31)38-18-12-13-22-44(38)7)43(9-2,10-3)36-17-14-16-35-40(36)41(45)39(32)37(26-30)42(35,5)6/h12-14,16-26,33H,8-11,15,27-28H2,1-7H3/q+2 |
| InChIKey | ZUBXIKKEWJHRPD-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|