C23H24N+ — CID 159863789
1-methyl-2-(2,5,9,9-tetramethylfluoren-1-yl)pyridin-1-ium (PubChem CID 159863789) has the molecular formula C23H24N+ and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-methyl-2-(2,5,9,9-tetramethylfluoren-1-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(2,5,9,9-tetramethylfluoren-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 159863789 |
| Molecular Formula | C23H24N+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-methyl-2-(2,5,9,9-tetramethylfluoren-1-yl)pyridin-1-ium |
| SMILES | Cc1cccc2c1-c1ccc(C)c(-c3cccc[n+]3C)c1C2(C)C |
| InChI | InChI=1S/C23H24N/c1-15-9-8-10-18-20(15)17-13-12-16(2)21(22(17)23(18,3)4)19-11-6-7-14-24(19)5/h6-14H,1-5H3/q+1 |
| InChIKey | CEGRPLWNDNTLBZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|