C23H21N2+ — CID 154615538
2-(8-isocyano-2,9,9-trimethylfluoren-1-yl)-1-methylpyridin-1-ium (PubChem CID 154615538) has the molecular formula C23H21N2+ and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-(8-isocyano-2,9,9-trimethylfluoren-1-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(8-isocyano-2,9,9-trimethylfluoren-1-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154615538 |
| Molecular Formula | C23H21N2+ |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-(8-isocyano-2,9,9-trimethylfluoren-1-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1cccc2c1C(C)(C)c1c-2ccc(C)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C23H21N2/c1-15-12-13-17-16-9-8-10-18(24-4)21(16)23(2,3)22(17)20(15)19-11-6-7-14-25(19)5/h6-14H,1-3,5H3/q+1 |
| InChIKey | NCNGTLVPXKPPBK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|