C24H23N2+ — CID 170252084
8-(1,5-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylfluorene-1-carbonitrile (PubChem CID 170252084) has the molecular formula C24H23N2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is 8-(1,5-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylfluorene-1-carbonitrile.
| Compound Name | 8-(1,5-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylfluorene-1-carbonitrile |
|---|---|
| PubChem CID | 170252084 |
| Molecular Formula | C24H23N2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 8-(1,5-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylfluorene-1-carbonitrile |
| SMILES | Cc1ccc(-c2c(C)ccc3c2C(C)(C)c2c(C#N)cccc2-3)[n+](C)c1 |
| InChI | InChI=1S/C24H23N2/c1-15-9-12-20(26(5)14-15)21-16(2)10-11-19-18-8-6-7-17(13-25)22(18)24(3,4)23(19)21/h6-12,14H,1-5H3/q+1 |
| InChIKey | NGLIQXQSEULOBU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|