C23H24N+ — CID 158548447
2-(1-deuterio-3,9,9-trimethylfluoren-4-yl)-1,5-dimethylpyridin-1-ium (PubChem CID 158548447) has the molecular formula C23H24N+ and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-(1-deuterio-3,9,9-trimethylfluoren-4-yl)-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-(1-deuterio-3,9,9-trimethylfluoren-4-yl)-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 158548447 |
| Molecular Formula | C23H24N+ |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-(1-deuterio-3,9,9-trimethylfluoren-4-yl)-1,5-dimethylpyridin-1-ium |
| SMILES | [2H]c1cc(C)c(-c2ccc(C)c[n+]2C)c2c1C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C23H24N/c1-15-10-13-20(24(5)14-15)21-16(2)11-12-19-22(21)17-8-6-7-9-18(17)23(19,3)4/h6-14H,1-5H3/q+1/i12D |
| InChIKey | SALQSNOTNZELOD-UQBWLURTSA-N |
| XLogP | 5.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|