C22H22N+ — CID 162063362
2-(6-deuterio-3,9,9-trimethylfluoren-4-yl)-1-methylpyridin-1-ium (PubChem CID 162063362) has the molecular formula C22H22N+ and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(6-deuterio-3,9,9-trimethylfluoren-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(6-deuterio-3,9,9-trimethylfluoren-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162063362 |
| Molecular Formula | C22H22N+ |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-(6-deuterio-3,9,9-trimethylfluoren-4-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]c1ccc2c(c1)-c1c(ccc(C)c1-c1cccc[n+]1C)C2(C)C |
| InChI | InChI=1S/C22H22N/c1-15-12-13-18-21(20(15)19-11-7-8-14-23(19)4)16-9-5-6-10-17(16)22(18,2)3/h5-14H,1-4H3/q+1/i5D |
| InChIKey | GLTWWAMURCDANX-UICOGKGYSA-N |
| XLogP | 4.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|