C25H28N+ — CID 157123369
2-[7-(2-deuteriopropan-2-yl)-3,9,9-trimethylfluoren-4-yl]-1-methylpyridin-1-ium (PubChem CID 157123369) has the molecular formula C25H28N+ and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-[7-(2-deuteriopropan-2-yl)-3,9,9-trimethylfluoren-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-(2-deuteriopropan-2-yl)-3,9,9-trimethylfluoren-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 157123369 |
| Molecular Formula | C25H28N+ |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-[7-(2-deuteriopropan-2-yl)-3,9,9-trimethylfluoren-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C(C)(C)c1ccc2c(c1)C(C)(C)c1ccc(C)c(-c3cccc[n+]3C)c1-2 |
| InChI | InChI=1S/C25H28N/c1-16(2)18-11-12-19-21(15-18)25(4,5)20-13-10-17(3)23(24(19)20)22-9-7-8-14-26(22)6/h7-16H,1-6H3/q+1/i16D |
| InChIKey | UCEYSTDAPGGWAI-QNLPYAOMSA-N |
| XLogP | 5.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|