C25H24NO2+ — CID 167317311
1,5-dimethyl-2-(9,11,11-trimethyl-[1]benzofuro[2,3-b]chromen-10-yl)pyridin-1-ium (PubChem CID 167317311) has the molecular formula C25H24NO2+ and a molecular weight of 370.47 g/mol. Its IUPAC name is 1,5-dimethyl-2-(9,11,11-trimethyl-[1]benzofuro[2,3-b]chromen-10-yl)pyridin-1-ium.
| Compound Name | 1,5-dimethyl-2-(9,11,11-trimethyl-[1]benzofuro[2,3-b]chromen-10-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167317311 |
| Molecular Formula | C25H24NO2+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1,5-dimethyl-2-(9,11,11-trimethyl-[1]benzofuro[2,3-b]chromen-10-yl)pyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)ccc3oc4c(c23)C(C)(C)c2ccccc2O4)[n+](C)c1 |
| InChI | InChI=1S/C25H24NO2/c1-15-10-12-18(26(5)14-15)21-16(2)11-13-20-22(21)23-24(28-20)27-19-9-7-6-8-17(19)25(23,3)4/h6-14H,1-5H3/q+1 |
| InChIKey | YOLOANGRRRCDDO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|