C40H34N5O+ — CID 167317372
1-(1,5-dimethylpyridin-1-ium-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,11,11-trimethyl-[1]benzofuro[2,3-b]quinoline (PubChem CID 167317372) has the molecular formula C40H34N5O+ and a molecular weight of 600.75 g/mol. Its IUPAC name is 1-(1,5-dimethylpyridin-1-ium-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,11,11-trimethyl-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 1-(1,5-dimethylpyridin-1-ium-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,11,11-trimethyl-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 167317372 |
| Molecular Formula | C40H34N5O+ |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 1-(1,5-dimethylpyridin-1-ium-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,11,11-trimethyl-[1]benzofuro[2,3-b]quinoline |
| SMILES | Cc1ccc(-c2c(C)ccc3oc4c(c23)C(C)(C)c2ccccc2N4c2nc(-c3ccccc3)nc(-c3ccccc3)n2)[n+](C)c1 |
| InChI | InChI=1S/C40H34N5O/c1-25-20-22-31(44(5)24-25)33-26(2)21-23-32-34(33)35-38(46-32)45(30-19-13-12-18-29(30)40(35,3)4)39-42-36(27-14-8-6-9-15-27)41-37(43-39)28-16-10-7-11-17-28/h6-24H,1-5H3/q+1 |
| InChIKey | OWWVNSCMIOPJHQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|