C30H29N2OSi+ — CID 162505958
6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-(4-trimethylsilylphenyl)dibenzofuran-1-carbonitrile (PubChem CID 162505958) has the molecular formula C30H29N2OSi+ and a molecular weight of 461.66 g/mol. Its IUPAC name is 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-(4-trimethylsilylphenyl)dibenzofuran-1-carbonitrile.
| Compound Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-(4-trimethylsilylphenyl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 162505958 |
| Molecular Formula | C30H29N2OSi+ |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-4-(4-trimethylsilylphenyl)dibenzofuran-1-carbonitrile |
| SMILES | Cc1ccc(-c2c(C)ccc3c2oc2c(-c4ccc([Si](C)(C)C)cc4)ccc(C#N)c23)[n+](C)c1 |
| InChI | InChI=1S/C30H29N2OSi/c1-19-7-16-26(32(3)18-19)27-20(2)8-14-25-28-22(17-31)11-15-24(29(28)33-30(25)27)21-9-12-23(13-10-21)34(4,5)6/h7-16,18H,1-6H3/q+1 |
| InChIKey | XYNNXMRMGGSHGM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|