C30H20FN2O+ — CID 169282870
7-methyl-4-naphthalen-2-yl-6-(3,4,6-trideuterio-5-fluoro-1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 169282870) has the molecular formula C30H20FN2O+ and a molecular weight of 446.52 g/mol. Its IUPAC name is 7-methyl-4-naphthalen-2-yl-6-(3,4,6-trideuterio-5-fluoro-1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 7-methyl-4-naphthalen-2-yl-6-(3,4,6-trideuterio-5-fluoro-1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 169282870 |
| Molecular Formula | C30H20FN2O+ |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 7-methyl-4-naphthalen-2-yl-6-(3,4,6-trideuterio-5-fluoro-1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | [2H]c1c([2H])c(-c2c(C)ccc3c2oc2c(-c4ccc5ccccc5c4)ccc(C#N)c23)[n+](C)c([2H])c1F |
| InChI | InChI=1S/C30H20FN2O/c1-18-7-12-25-28-22(16-32)10-13-24(21-9-8-19-5-3-4-6-20(19)15-21)29(28)34-30(25)27(18)26-14-11-23(31)17-33(26)2/h3-15,17H,1-2H3/q+1/i11D,14D,17D |
| InChIKey | AOLKQJQNZRDXAQ-XETIFYLOSA-N |
| XLogP | 7.22 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|