C23H23N2Si+ — CID 154615473
4-(1,5-dimethylpyridin-1-ium-2-yl)-3,5,5-trimethylbenzo[b][1]benzosilole-9-carbonitrile (PubChem CID 154615473) has the molecular formula C23H23N2Si+ and a molecular weight of 355.54 g/mol. Its IUPAC name is 4-(1,5-dimethylpyridin-1-ium-2-yl)-3,5,5-trimethylbenzo[b][1]benzosilole-9-carbonitrile.
| Compound Name | 4-(1,5-dimethylpyridin-1-ium-2-yl)-3,5,5-trimethylbenzo[b][1]benzosilole-9-carbonitrile |
|---|---|
| PubChem CID | 154615473 |
| Molecular Formula | C23H23N2Si+ |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-(1,5-dimethylpyridin-1-ium-2-yl)-3,5,5-trimethylbenzo[b][1]benzosilole-9-carbonitrile |
| SMILES | Cc1ccc(-c2c(C)ccc3c2[Si](C)(C)c2cccc(C#N)c2-3)[n+](C)c1 |
| InChI | InChI=1S/C23H23N2Si/c1-15-9-12-19(25(3)14-15)21-16(2)10-11-18-22-17(13-24)7-6-8-20(22)26(4,5)23(18)21/h6-12,14H,1-5H3/q+1 |
| InChIKey | IBAOIQXQOZJDDC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|