C21H17N2Se+ — CID 170530590
6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyldibenzoselenophene-3-carbonitrile (PubChem CID 170530590) has the molecular formula C21H17N2Se+ and a molecular weight of 376.34 g/mol. Its IUPAC name is 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyldibenzoselenophene-3-carbonitrile.
| Compound Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyldibenzoselenophene-3-carbonitrile |
|---|---|
| PubChem CID | 170530590 |
| Molecular Formula | C21H17N2Se+ |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-7-methyldibenzoselenophene-3-carbonitrile |
| SMILES | Cc1ccc(-c2c(C)ccc3c2[se]c2cc(C#N)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C21H17N2Se/c1-13-4-9-18(23(3)12-13)20-14(2)5-7-17-16-8-6-15(11-22)10-19(16)24-21(17)20/h4-10,12H,1-3H3/q+1 |
| InChIKey | HALFLPBXGFEESU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|