C33H28FN2Si+ — CID 169283096
6-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5,5,7-trimethyl-4-naphthalen-2-ylbenzo[b][1]benzosilole-3-carbonitrile (PubChem CID 169283096) has the molecular formula C33H28FN2Si+ and a molecular weight of 502.70 g/mol. Its IUPAC name is 6-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5,5,7-trimethyl-4-naphthalen-2-ylbenzo[b][1]benzosilole-3-carbonitrile.
| Compound Name | 6-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5,5,7-trimethyl-4-naphthalen-2-ylbenzo[b][1]benzosilole-3-carbonitrile |
|---|---|
| PubChem CID | 169283096 |
| Molecular Formula | C33H28FN2Si+ |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 6-[4-fluoro-1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-5,5,7-trimethyl-4-naphthalen-2-ylbenzo[b][1]benzosilole-3-carbonitrile |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2[Si](C)(C)c2c-3ccc(C#N)c2-c2ccc3ccccc3c2)cc1F |
| InChI | InChI=1S/C33H28FN2Si/c1-20-10-14-26-27-15-13-25(18-35)31(24-12-11-22-8-6-7-9-23(22)16-24)33(27)37(4,5)32(26)30(20)29-17-28(34)21(2)19-36(29)3/h6-17,19H,1-5H3/q+1/i2D3 |
| InChIKey | DIKOKVKHAXEIIU-BMSJAHLVSA-N |
| XLogP | 6.43 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|