C30H29N2Si+ — CID 162505913
2-(3-isocyano-5,5,7-trimethyl-4-phenylbenzo[b][1]benzosilol-6-yl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 162505913) has the molecular formula C30H29N2Si+ and a molecular weight of 445.66 g/mol. Its IUPAC name is 2-(3-isocyano-5,5,7-trimethyl-4-phenylbenzo[b][1]benzosilol-6-yl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(3-isocyano-5,5,7-trimethyl-4-phenylbenzo[b][1]benzosilol-6-yl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 162505913 |
| Molecular Formula | C30H29N2Si+ |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-(3-isocyano-5,5,7-trimethyl-4-phenylbenzo[b][1]benzosilol-6-yl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(c1-c1ccccc1)[Si](C)(C)c1c-2ccc(C)c1-c1cc(C)c(C)c[n+]1C |
| InChI | InChI=1S/C30H29N2Si/c1-19-13-14-23-24-15-16-25(31-4)28(22-11-9-8-10-12-22)30(24)33(6,7)29(23)27(19)26-17-20(2)21(3)18-32(26)5/h8-18H,1-3,5-7H3/q+1 |
| InChIKey | WUBMGKWJXCURQC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|