C22H22NO+ — CID 158626019
1,4-dimethyl-2-(6-methyl-2,3-dihydro-1-benzofuran-7-yl)-5-phenylpyridin-1-ium (PubChem CID 158626019) has the molecular formula C22H22NO+ and a molecular weight of 316.42 g/mol. Its IUPAC name is 1,4-dimethyl-2-(6-methyl-2,3-dihydro-1-benzofuran-7-yl)-5-phenylpyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(6-methyl-2,3-dihydro-1-benzofuran-7-yl)-5-phenylpyridin-1-ium |
|---|---|
| PubChem CID | 158626019 |
| Molecular Formula | C22H22NO+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1,4-dimethyl-2-(6-methyl-2,3-dihydro-1-benzofuran-7-yl)-5-phenylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2OCC3)[n+](C)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H22NO/c1-15-9-10-18-11-12-24-22(18)21(15)20-13-16(2)19(14-23(20)3)17-7-5-4-6-8-17/h4-10,13-14H,11-12H2,1-3H3/q+1 |
| InChIKey | GAMNOSTUKDHJIS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|