C25H28NO+ — CID 157351072
1,4-dimethyl-5-phenyl-2-(2,2,7-trimethyl-3,4-dihydrochromen-8-yl)pyridin-1-ium (PubChem CID 157351072) has the molecular formula C25H28NO+ and a molecular weight of 358.51 g/mol. Its IUPAC name is 1,4-dimethyl-5-phenyl-2-(2,2,7-trimethyl-3,4-dihydrochromen-8-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-5-phenyl-2-(2,2,7-trimethyl-3,4-dihydrochromen-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 157351072 |
| Molecular Formula | C25H28NO+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1,4-dimethyl-5-phenyl-2-(2,2,7-trimethyl-3,4-dihydrochromen-8-yl)pyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2OC(C)(C)CC3)[n+](C)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H28NO/c1-17-11-12-20-13-14-25(3,4)27-24(20)23(17)22-15-18(2)21(16-26(22)5)19-9-7-6-8-10-19/h6-12,15-16H,13-14H2,1-5H3/q+1 |
| InChIKey | MMDFNEHHDULIJO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|