C22H28NO+ — CID 158807229
1,4-dimethyl-2-(6-methylspiro[3H-1-benzofuran-2,1'-cyclohexane]-7-yl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 158807229) has the molecular formula C22H28NO+ and a molecular weight of 325.49 g/mol. Its IUPAC name is 1,4-dimethyl-2-(6-methylspiro[3H-1-benzofuran-2,1'-cyclohexane]-7-yl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(6-methylspiro[3H-1-benzofuran-2,1'-cyclohexane]-7-yl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 158807229 |
| Molecular Formula | C22H28NO+ |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 1,4-dimethyl-2-(6-methylspiro[3H-1-benzofuran-2,1'-cyclohexane]-7-yl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2OC2(CCCCC2)C3)cc1C |
| InChI | InChI=1S/C22H28NO/c1-15-8-9-18-13-22(10-6-5-7-11-22)24-21(18)20(15)19-12-16(2)17(3)14-23(19)4/h8-9,12,14H,5-7,10-11,13H2,1-4H3/q+1/i3D3 |
| InChIKey | CZGNHYGBXYJLSU-HPRDVNIFSA-N |
| XLogP | 4.74 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|