C25H28NO+ — CID 140899524
2-methyl-3-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-7-yl)isoquinolin-2-ium (PubChem CID 140899524) has the molecular formula C25H28NO+ and a molecular weight of 358.51 g/mol. Its IUPAC name is 2-methyl-3-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-7-yl)isoquinolin-2-ium.
| Compound Name | 2-methyl-3-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-7-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 140899524 |
| Molecular Formula | C25H28NO+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-methyl-3-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-7-yl)isoquinolin-2-ium |
| SMILES | Cc1ccc2c(c1-c1cc3ccccc3c[n+]1C)OC(C)(C)C21CCCC1 |
| InChI | InChI=1S/C25H28NO/c1-17-11-12-20-23(27-24(2,3)25(20)13-7-8-14-25)22(17)21-15-18-9-5-6-10-19(18)16-26(21)4/h5-6,9-12,15-16H,7-8,13-14H2,1-4H3/q+1 |
| InChIKey | DYAMQKUMHGNIJD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|