C26H30NO+ — CID 140899468
1-methyl-2-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclohexane]-7-yl)quinolin-1-ium (PubChem CID 140899468) has the molecular formula C26H30NO+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-methyl-2-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclohexane]-7-yl)quinolin-1-ium.
| Compound Name | 1-methyl-2-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclohexane]-7-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 140899468 |
| Molecular Formula | C26H30NO+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-methyl-2-(2,2,6-trimethylspiro[1-benzofuran-3,1'-cyclohexane]-7-yl)quinolin-1-ium |
| SMILES | Cc1ccc2c(c1-c1ccc3ccccc3[n+]1C)OC(C)(C)C21CCCCC1 |
| InChI | InChI=1S/C26H30NO/c1-18-12-14-20-24(28-25(2,3)26(20)16-8-5-9-17-26)23(18)22-15-13-19-10-6-7-11-21(19)27(22)4/h6-7,10-15H,5,8-9,16-17H2,1-4H3/q+1 |
| InChIKey | PXUYCYRICHKEIO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|